C12H10N6O3 — CID 169343746
methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-hydroxybenzoate (PubChem CID 169343746) has the molecular formula C12H10N6O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 169343746 |
| Molecular Formula | C12H10N6O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NC=C(C#N)c2nn[nH]n2)c1O |
| InChI | InChI=1S/C12H10N6O3/c1-21-12(20)8-3-2-4-9(10(8)19)14-6-7(5-13)11-15-17-18-16-11/h2-4,6,14,19H,1H3,(H,15,16,17,18) |
| InChIKey | GKTXOQFRUMCMGY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|