C20H18N6O3 — CID 169343838
methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methyl-2-phenylmethoxybenzoate (PubChem CID 169343838) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methyl-2-phenylmethoxybenzoate.
| Compound Name | methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methyl-2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 169343838 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methyl-2-phenylmethoxybenzoate |
| SMILES | COC(=O)c1cc(C)cc(NC=C(C#N)c2nn[nH]n2)c1OCc1ccccc1 |
| InChI | InChI=1S/C20H18N6O3/c1-13-8-16(20(27)28-2)18(29-12-14-6-4-3-5-7-14)17(9-13)22-11-15(10-21)19-23-25-26-24-19/h3-9,11,22H,12H2,1-2H3,(H,23,24,25,26) |
| InChIKey | FWSVRQKTXVFJLT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|