C13H12N6O2 — CID 169342777
methyl 2-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetate (PubChem CID 169342777) has the molecular formula C13H12N6O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is methyl 2-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 169342777 |
| Molecular Formula | C13H12N6O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | methyl 2-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(NC=C(C#N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C13H12N6O2/c1-21-12(20)6-9-3-2-4-11(5-9)15-8-10(7-14)13-16-18-19-17-13/h2-5,8,15H,6H2,1H3,(H,16,17,18,19) |
| InChIKey | BVHFJONPPUGKPZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|