C11H10N6O — CID 169342243
3-[3-(hydroxymethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342243) has the molecular formula C11H10N6O and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-(hydroxymethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342243 |
| Molecular Formula | C11H10N6O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-[3-(hydroxymethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cccc(CO)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C11H10N6O/c12-5-9(11-14-16-17-15-11)6-13-10-3-1-2-8(4-10)7-18/h1-4,6,13,18H,7H2,(H,14,15,16,17) |
| InChIKey | ZDYXGAVHTXDDKB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|