C13H10F2N6 — CID 169345998
3-[3-(2,2-difluorocyclopropyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345998) has the molecular formula C13H10F2N6 and a molecular weight of 288.26 g/mol. Its IUPAC name is 3-[3-(2,2-difluorocyclopropyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-(2,2-difluorocyclopropyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345998 |
| Molecular Formula | C13H10F2N6 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-[3-(2,2-difluorocyclopropyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cccc(C2CC2(F)F)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C13H10F2N6/c14-13(15)5-11(13)8-2-1-3-10(4-8)17-7-9(6-16)12-18-20-21-19-12/h1-4,7,11,17H,5H2,(H,18,19,20,21) |
| InChIKey | OSYABOXUMXGBAO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|