C17H13N7O — CID 169342731
N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]benzamide (PubChem CID 169342731) has the molecular formula C17H13N7O and a molecular weight of 331.34 g/mol. Its IUPAC name is N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]benzamide.
| Compound Name | N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 169342731 |
| Molecular Formula | C17H13N7O |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]benzamide |
| SMILES | N#CC(=CNc1cccc(NC(=O)c2ccccc2)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C17H13N7O/c18-10-13(16-21-23-24-22-16)11-19-14-7-4-8-15(9-14)20-17(25)12-5-2-1-3-6-12/h1-9,11,19H,(H,20,25)(H,21,22,23,24) |
| InChIKey | GDDYLZXUOPAMER-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|