C17H12ClN7O — CID 169346329
N-(3-chlorophenyl)-3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzamide (PubChem CID 169346329) has the molecular formula C17H12ClN7O and a molecular weight of 365.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzamide.
| Compound Name | N-(3-chlorophenyl)-3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzamide |
|---|---|
| PubChem CID | 169346329 |
| Molecular Formula | C17H12ClN7O |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-(3-chlorophenyl)-3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzamide |
| SMILES | N#CC(=CNc1cccc(C(=O)Nc2cccc(Cl)c2)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C17H12ClN7O/c18-13-4-2-6-15(8-13)21-17(26)11-3-1-5-14(7-11)20-10-12(9-19)16-22-24-25-23-16/h1-8,10,20H,(H,21,26)(H,22,23,24,25) |
| InChIKey | VFVBJXOZYFQPRT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|