C19H17N7O3 — CID 169347008
3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,5-dimethoxyphenyl)benzamide (PubChem CID 169347008) has the molecular formula C19H17N7O3 and a molecular weight of 391.39 g/mol. Its IUPAC name is 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,5-dimethoxyphenyl)benzamide.
| Compound Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,5-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 169347008 |
| Molecular Formula | C19H17N7O3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,5-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cccc(NC=C(C#N)c3nn[nH]n3)c2)c1 |
| InChI | InChI=1S/C19H17N7O3/c1-28-15-6-7-17(29-2)16(9-15)22-19(27)12-4-3-5-14(8-12)21-11-13(10-20)18-23-25-26-24-18/h3-9,11,21H,1-2H3,(H,22,27)(H,23,24,25,26) |
| InChIKey | JPRAJPVOAGPKHO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|