C19H17N7O — CID 169343133
3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,6-dimethylphenyl)benzamide (PubChem CID 169343133) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,6-dimethylphenyl)benzamide.
| Compound Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,6-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 169343133 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(2,6-dimethylphenyl)benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cccc(NC=C(C#N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C19H17N7O/c1-12-5-3-6-13(2)17(12)22-19(27)14-7-4-8-16(9-14)21-11-15(10-20)18-23-25-26-24-18/h3-9,11,21H,1-2H3,(H,22,27)(H,23,24,25,26) |
| InChIKey | MIVSYUXHUIQUIP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|