C18H15N7O — CID 169343177
N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]-2-phenylacetamide (PubChem CID 169343177) has the molecular formula C18H15N7O and a molecular weight of 345.37 g/mol. Its IUPAC name is N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]-2-phenylacetamide.
| Compound Name | N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 169343177 |
| Molecular Formula | C18H15N7O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]-2-phenylacetamide |
| SMILES | N#CC(=CNc1cccc(NC(=O)Cc2ccccc2)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C18H15N7O/c19-11-14(18-22-24-25-23-18)12-20-15-7-4-8-16(10-15)21-17(26)9-13-5-2-1-3-6-13/h1-8,10,12,20H,9H2,(H,21,26)(H,22,23,24,25) |
| InChIKey | OOYQTJXLLJBOBM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|