C12H10N6O2 — CID 169346937
2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetic acid (PubChem CID 169346937) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 169346937 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetic acid |
| SMILES | N#CC(=CNc1ccc(CC(=O)O)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C12H10N6O2/c13-6-9(12-15-17-18-16-12)7-14-10-3-1-8(2-4-10)5-11(19)20/h1-4,7,14H,5H2,(H,19,20)(H,15,16,17,18) |
| InChIKey | AOTCVAVJBFTVAU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|