C13H14N6O3S — CID 169344609
3-[4-(2-hydroxyethylsulfonylmethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344609) has the molecular formula C13H14N6O3S and a molecular weight of 334.36 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethylsulfonylmethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-(2-hydroxyethylsulfonylmethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344609 |
| Molecular Formula | C13H14N6O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-[4-(2-hydroxyethylsulfonylmethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(CS(=O)(=O)CCO)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C13H14N6O3S/c14-7-11(13-16-18-19-17-13)8-15-12-3-1-10(2-4-12)9-23(21,22)6-5-20/h1-4,8,15,20H,5-6,9H2,(H,16,17,18,19) |
| InChIKey | YEKZZOLGSQILHO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|