C18H17N7O2S — CID 169345296
N-benzyl-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-methylbenzenesulfonamide (PubChem CID 169345296) has the molecular formula C18H17N7O2S and a molecular weight of 395.45 g/mol. Its IUPAC name is N-benzyl-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-methylbenzenesulfonamide.
| Compound Name | N-benzyl-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169345296 |
| Molecular Formula | C18H17N7O2S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-benzyl-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-methylbenzenesulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(NC=C(C#N)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C18H17N7O2S/c1-25(13-14-5-3-2-4-6-14)28(26,27)17-9-7-16(8-10-17)20-12-15(11-19)18-21-23-24-22-18/h2-10,12,20H,13H2,1H3,(H,21,22,23,24) |
| InChIKey | AUKYOUAUCBGPOQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|