C20H21N7 — CID 169346346
3-[2-[[benzyl(ethyl)amino]methyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346346) has the molecular formula C20H21N7 and a molecular weight of 359.44 g/mol. Its IUPAC name is 3-[2-[[benzyl(ethyl)amino]methyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-[[benzyl(ethyl)amino]methyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346346 |
| Molecular Formula | C20H21N7 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 3-[2-[[benzyl(ethyl)amino]methyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CCN(Cc1ccccc1)Cc1ccccc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C20H21N7/c1-2-27(14-16-8-4-3-5-9-16)15-17-10-6-7-11-19(17)22-13-18(12-21)20-23-25-26-24-20/h3-11,13,22H,2,14-15H2,1H3,(H,23,24,25,26) |
| InChIKey | JQLBVEAWTKYPCX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|