C17H11N7 — CID 169342177
3-(acridin-9-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342177) has the molecular formula C17H11N7 and a molecular weight of 313.32 g/mol. Its IUPAC name is 3-(acridin-9-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(acridin-9-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342177 |
| Molecular Formula | C17H11N7 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-(acridin-9-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1c2ccccc2nc2ccccc12)c1nn[nH]n1 |
| InChI | InChI=1S/C17H11N7/c18-9-11(17-21-23-24-22-17)10-19-16-12-5-1-3-7-14(12)20-15-8-4-2-6-13(15)16/h1-8,10H,(H,19,20)(H,21,22,23,24) |
| InChIKey | LBPXNXSDODKLTF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|