C16H10N6S — CID 169342804
3-(dibenzothiophen-3-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342804) has the molecular formula C16H10N6S and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-(dibenzothiophen-3-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(dibenzothiophen-3-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342804 |
| Molecular Formula | C16H10N6S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-(dibenzothiophen-3-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc2c(c1)sc1ccccc12)c1nn[nH]n1 |
| InChI | InChI=1S/C16H10N6S/c17-8-10(16-19-21-22-20-16)9-18-11-5-6-13-12-3-1-2-4-14(12)23-15(13)7-11/h1-7,9,18H,(H,19,20,21,22) |
| InChIKey | IEYGRXBXXOVGGR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|