C12H10N8 — CID 169346229
5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(methylamino)benzonitrile (PubChem CID 169346229) has the molecular formula C12H10N8 and a molecular weight of 266.27 g/mol. Its IUPAC name is 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(methylamino)benzonitrile.
| Compound Name | 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(methylamino)benzonitrile |
|---|---|
| PubChem CID | 169346229 |
| Molecular Formula | C12H10N8 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(methylamino)benzonitrile |
| SMILES | CNc1ccc(NC=C(C#N)c2nn[nH]n2)cc1C#N |
| InChI | InChI=1S/C12H10N8/c1-15-11-3-2-10(4-8(11)5-13)16-7-9(6-14)12-17-19-20-18-12/h2-4,7,15-16H,1H3,(H,17,18,19,20) |
| InChIKey | MDIJESAXAWVGJF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 126.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|