C16H15N7 — CID 169346840
3-[3-(2,5-dimethylpyrrol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346840) has the molecular formula C16H15N7 and a molecular weight of 305.35 g/mol. Its IUPAC name is 3-[3-(2,5-dimethylpyrrol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-(2,5-dimethylpyrrol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346840 |
| Molecular Formula | C16H15N7 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-[3-(2,5-dimethylpyrrol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(C)n1-c1cccc(NC=C(C#N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C16H15N7/c1-11-6-7-12(2)23(11)15-5-3-4-14(8-15)18-10-13(9-17)16-19-21-22-20-16/h3-8,10,18H,1-2H3,(H,19,20,21,22) |
| InChIKey | GRIWXSPPJUGJEZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|