C14H12N8O2 — CID 169346372
3-[3-(4-methyl-2,5-dioxoimidazolidin-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346372) has the molecular formula C14H12N8O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is 3-[3-(4-methyl-2,5-dioxoimidazolidin-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-(4-methyl-2,5-dioxoimidazolidin-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346372 |
| Molecular Formula | C14H12N8O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-[3-(4-methyl-2,5-dioxoimidazolidin-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC1NC(=O)N(c2cccc(NC=C(C#N)c3nn[nH]n3)c2)C1=O |
| InChI | InChI=1S/C14H12N8O2/c1-8-13(23)22(14(24)17-8)11-4-2-3-10(5-11)16-7-9(6-15)12-18-20-21-19-12/h2-5,7-8,16H,1H3,(H,17,24)(H,18,19,20,21) |
| InChIKey | CPYWAFFYLFUAKA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|