C14H13N7O2 — CID 169343524
3-[(2,4-dimethyl-3-oxo-1,4-benzoxazin-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343524) has the molecular formula C14H13N7O2 and a molecular weight of 311.31 g/mol. Its IUPAC name is 3-[(2,4-dimethyl-3-oxo-1,4-benzoxazin-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(2,4-dimethyl-3-oxo-1,4-benzoxazin-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343524 |
| Molecular Formula | C14H13N7O2 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[(2,4-dimethyl-3-oxo-1,4-benzoxazin-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC1Oc2cc(NC=C(C#N)c3nn[nH]n3)ccc2N(C)C1=O |
| InChI | InChI=1S/C14H13N7O2/c1-8-14(22)21(2)11-4-3-10(5-12(11)23-8)16-7-9(6-15)13-17-19-20-18-13/h3-5,7-8,16H,1-2H3,(H,17,18,19,20) |
| InChIKey | ADIOBJXMZQTTDO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|