C16H15N7O2 — CID 169343253
3-[[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343253) has the molecular formula C16H15N7O2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-[[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343253 |
| Molecular Formula | C16H15N7O2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-[[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC(C)CN1C(=O)c2ccc(NC=C(C#N)c3nn[nH]n3)cc2C1=O |
| InChI | InChI=1S/C16H15N7O2/c1-9(2)8-23-15(24)12-4-3-11(5-13(12)16(23)25)18-7-10(6-17)14-19-21-22-20-14/h3-5,7,9,18H,8H2,1-2H3,(H,19,20,21,22) |
| InChIKey | RWEVPQNDTONIGW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|