C13H13N7O2 — CID 169346232
5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(dimethylamino)benzoic acid (PubChem CID 169346232) has the molecular formula C13H13N7O2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(dimethylamino)benzoic acid.
| Compound Name | 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(dimethylamino)benzoic acid |
|---|---|
| PubChem CID | 169346232 |
| Molecular Formula | C13H13N7O2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(dimethylamino)benzoic acid |
| SMILES | CN(C)c1ccc(NC=C(C#N)c2nn[nH]n2)cc1C(=O)O |
| InChI | InChI=1S/C13H13N7O2/c1-20(2)11-4-3-9(5-10(11)13(21)22)15-7-8(6-14)12-16-18-19-17-12/h3-5,7,15H,1-2H3,(H,21,22)(H,16,17,18,19) |
| InChIKey | IPMXOVMXVORZNO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|