C13H9F3N6O2 — CID 169343409
methyl 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(trifluoromethyl)benzoate (PubChem CID 169343409) has the molecular formula C13H9F3N6O2 and a molecular weight of 338.25 g/mol. Its IUPAC name is methyl 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(trifluoromethyl)benzoate.
| Compound Name | methyl 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 169343409 |
| Molecular Formula | C13H9F3N6O2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(NC=C(C#N)c2nn[nH]n2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H9F3N6O2/c1-24-12(23)9-3-2-8(4-10(9)13(14,15)16)18-6-7(5-17)11-19-21-22-20-11/h2-4,6,18H,1H3,(H,19,20,21,22) |
| InChIKey | CGEUYVHGAOGPBY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|