C12H7F5N6O — CID 169344628
3-[5-(difluoromethoxy)-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344628) has the molecular formula C12H7F5N6O and a molecular weight of 346.22 g/mol. Its IUPAC name is 3-[5-(difluoromethoxy)-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[5-(difluoromethoxy)-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344628 |
| Molecular Formula | C12H7F5N6O |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 3-[5-(difluoromethoxy)-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(OC(F)F)ccc1C(F)(F)F)c1nn[nH]n1 |
| InChI | InChI=1S/C12H7F5N6O/c13-11(14)24-7-1-2-8(12(15,16)17)9(3-7)19-5-6(4-18)10-20-22-23-21-10/h1-3,5,11,19H,(H,20,21,22,23) |
| InChIKey | VFXYZGGCRDGWGE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|