C17H10F4N6O — CID 169346973
3-[4-(4-fluorophenoxy)-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346973) has the molecular formula C17H10F4N6O and a molecular weight of 390.30 g/mol. Its IUPAC name is 3-[4-(4-fluorophenoxy)-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-(4-fluorophenoxy)-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346973 |
| Molecular Formula | C17H10F4N6O |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 3-[4-(4-fluorophenoxy)-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(Oc2ccc(F)cc2)cc1C(F)(F)F)c1nn[nH]n1 |
| InChI | InChI=1S/C17H10F4N6O/c18-11-1-3-12(4-2-11)28-13-5-6-15(14(7-13)17(19,20)21)23-9-10(8-22)16-24-26-27-25-16/h1-7,9,23H,(H,24,25,26,27) |
| InChIKey | ONTCMLVOGJHSCX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|