C11H4F6N6 — CID 169343975
2-(2H-tetrazol-5-yl)-3-[2,3,5-trifluoro-4-(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 169343975) has the molecular formula C11H4F6N6 and a molecular weight of 334.18 g/mol. Its IUPAC name is 2-(2H-tetrazol-5-yl)-3-[2,3,5-trifluoro-4-(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | 2-(2H-tetrazol-5-yl)-3-[2,3,5-trifluoro-4-(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 169343975 |
| Molecular Formula | C11H4F6N6 |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-(2H-tetrazol-5-yl)-3-[2,3,5-trifluoro-4-(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(F)c(C(F)(F)F)c(F)c1F)c1nn[nH]n1 |
| InChI | InChI=1S/C11H4F6N6/c12-5-1-6(8(13)9(14)7(5)11(15,16)17)19-3-4(2-18)10-20-22-23-21-10/h1,3,19H,(H,20,21,22,23) |
| InChIKey | FHHYJMSIMNHJHE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|