C10H5F3N6 — CID 169342350
2-(2H-tetrazol-5-yl)-3-(3,4,5-trifluoroanilino)prop-2-enenitrile (PubChem CID 169342350) has the molecular formula C10H5F3N6 and a molecular weight of 266.19 g/mol. Its IUPAC name is 2-(2H-tetrazol-5-yl)-3-(3,4,5-trifluoroanilino)prop-2-enenitrile.
| Compound Name | 2-(2H-tetrazol-5-yl)-3-(3,4,5-trifluoroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342350 |
| Molecular Formula | C10H5F3N6 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(2H-tetrazol-5-yl)-3-(3,4,5-trifluoroanilino)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(F)c(F)c(F)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C10H5F3N6/c11-7-1-6(2-8(12)9(7)13)15-4-5(3-14)10-16-18-19-17-10/h1-2,4,15H,(H,16,17,18,19) |
| InChIKey | YSYWBVCKBXUCDI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|