C12H3F3N8 — CID 169344733
2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3,5,6-trifluorobenzene-1,4-dicarbonitrile (PubChem CID 169344733) has the molecular formula C12H3F3N8 and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3,5,6-trifluorobenzene-1,4-dicarbonitrile.
| Compound Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3,5,6-trifluorobenzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 169344733 |
| Molecular Formula | C12H3F3N8 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3,5,6-trifluorobenzene-1,4-dicarbonitrile |
| SMILES | N#CC(=CNc1c(F)c(C#N)c(F)c(F)c1C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C12H3F3N8/c13-8-6(2-17)10(15)11(7(3-18)9(8)14)19-4-5(1-16)12-20-22-23-21-12/h4,19H,(H,20,21,22,23) |
| InChIKey | SZQJHBYDBJQMPX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 137.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|