C11H6F2N6O2 — CID 169346313
2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3,6-difluorobenzoic acid (PubChem CID 169346313) has the molecular formula C11H6F2N6O2 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3,6-difluorobenzoic acid.
| Compound Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 169346313 |
| Molecular Formula | C11H6F2N6O2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3,6-difluorobenzoic acid |
| SMILES | N#CC(=CNc1c(F)ccc(F)c1C(=O)O)c1nn[nH]n1 |
| InChI | InChI=1S/C11H6F2N6O2/c12-6-1-2-7(13)9(8(6)11(20)21)15-4-5(3-14)10-16-18-19-17-10/h1-2,4,15H,(H,20,21)(H,16,17,18,19) |
| InChIKey | YPRMROKGTMAURC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|