C12H9ClN6O2 — CID 169343904
6-chloro-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-methylbenzoic acid (PubChem CID 169343904) has the molecular formula C12H9ClN6O2 and a molecular weight of 304.70 g/mol. Its IUPAC name is 6-chloro-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-methylbenzoic acid.
| Compound Name | 6-chloro-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 169343904 |
| Molecular Formula | C12H9ClN6O2 |
| Molecular Weight | 304.70 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 6-chloro-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-methylbenzoic acid |
| SMILES | Cc1ccc(Cl)c(C(=O)O)c1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C12H9ClN6O2/c1-6-2-3-8(13)9(12(20)21)10(6)15-5-7(4-14)11-16-18-19-17-11/h2-3,5,15H,1H3,(H,20,21)(H,16,17,18,19) |
| InChIKey | XVWQFCJOQLGENT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.70 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|