C11H7N7O4 — CID 169342609
4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-nitrobenzoic acid (PubChem CID 169342609) has the molecular formula C11H7N7O4 and a molecular weight of 301.22 g/mol. Its IUPAC name is 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-nitrobenzoic acid.
| Compound Name | 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 169342609 |
| Molecular Formula | C11H7N7O4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-nitrobenzoic acid |
| SMILES | N#CC(=CNc1ccc(C(=O)O)c([N+](=O)[O-])c1)c1nn[nH]n1 |
| InChI | InChI=1S/C11H7N7O4/c12-4-6(10-14-16-17-15-10)5-13-7-1-2-8(11(19)20)9(3-7)18(21)22/h1-3,5,13H,(H,19,20)(H,14,15,16,17) |
| InChIKey | LCWUWNWSKOBDCO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 170.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|