C16H18N8O3 — CID 169343041
3-[4-(2,6-dimethylmorpholin-4-yl)-3-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343041) has the molecular formula C16H18N8O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 3-[4-(2,6-dimethylmorpholin-4-yl)-3-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-(2,6-dimethylmorpholin-4-yl)-3-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343041 |
| Molecular Formula | C16H18N8O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-[4-(2,6-dimethylmorpholin-4-yl)-3-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC1CN(c2ccc(NC=C(C#N)c3nn[nH]n3)cc2[N+](=O)[O-])CC(C)O1 |
| InChI | InChI=1S/C16H18N8O3/c1-10-8-23(9-11(2)27-10)14-4-3-13(5-15(14)24(25)26)18-7-12(6-17)16-19-21-22-20-16/h3-5,7,10-11,18H,8-9H2,1-2H3,(H,19,20,21,22) |
| InChIKey | UJABCENDMOLWIO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|