C20H30N4O5 — CID 9116895
2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-nitrophenyl]acetamide (PubChem CID 9116895) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-nitrophenyl]acetamide.
| Compound Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 9116895 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-nitrophenyl]acetamide |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)CN3C[C@H](C)O[C@@H](C)C3)cc2[N+](=O)[O-])C[C@H](C)O1 |
| InChI | InChI=1S/C20H30N4O5/c1-13-8-22(9-14(2)28-13)12-20(25)21-17-5-6-18(19(7-17)24(26)27)23-10-15(3)29-16(4)11-23/h5-7,13-16H,8-12H2,1-4H3,(H,21,25)/t13-,14-,15-,16+/m0/s1 |
| InChIKey | OVKBQVHTBUJAAS-YHUYYLMFSA-N |
| XLogP | 2.26 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|