C15H20N2O5 — CID 100804415
ethyl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-nitrobenzoate (PubChem CID 100804415) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is ethyl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-nitrobenzoate.
| Compound Name | ethyl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 100804415 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(N2C[C@H](C)O[C@@H](C)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H20N2O5/c1-4-21-15(18)12-5-6-13(14(7-12)17(19)20)16-8-10(2)22-11(3)9-16/h5-7,10-11H,4,8-9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | IKIWTQRZRZWABM-QWRGUYRKSA-N |
| XLogP | 2.39 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|