C16H20N2O7 — CID 16958743
[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 4-methoxy-3-nitrobenzoate (PubChem CID 16958743) has the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. Its IUPAC name is [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 4-methoxy-3-nitrobenzoate.
| Compound Name | [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 16958743 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N2CC(C)OC(C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N2O7/c1-10-7-17(8-11(2)25-10)15(19)9-24-16(20)12-4-5-14(23-3)13(6-12)18(21)22/h4-6,10-11H,7-9H2,1-3H3 |
| InChIKey | YQZILAZWVQCLQA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|