C17H20N2O8 — CID 2617878
3-O-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 2617878) has the molecular formula C17H20N2O8 and a molecular weight of 380.35 g/mol. Its IUPAC name is 3-O-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2617878 |
| Molecular Formula | C17H20N2O8 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-O-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCC(=O)N2C[C@@H](C)O[C@@H](C)C2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H20N2O8/c1-10-7-18(8-11(2)27-10)15(20)9-26-17(22)13-4-12(16(21)25-3)5-14(6-13)19(23)24/h4-6,10-11H,7-9H2,1-3H3/t10-,11+ |
| InChIKey | GPSXZBVSVCNSSM-PHIMTYICSA-N |
| XLogP | 1.17 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|