C17H23N3O7 — CID 7989965
[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate (PubChem CID 7989965) has the molecular formula C17H23N3O7 and a molecular weight of 381.39 g/mol. Its IUPAC name is [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate.
| Compound Name | [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7989965 |
| Molecular Formula | C17H23N3O7 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| SMILES | C[C@@H]1CN(C(=O)COC(=O)c2cc([N+](=O)[O-])ccc2NCCO)C[C@@H](C)O1 |
| InChI | InChI=1S/C17H23N3O7/c1-11-8-19(9-12(2)27-11)16(22)10-26-17(23)14-7-13(20(24)25)3-4-15(14)18-5-6-21/h3-4,7,11-12,18,21H,5-6,8-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | KULWDRUAIQWUJJ-VXGBXAGGSA-N |
| XLogP | 0.79 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|