C17H14F2N2O6 — CID 3373500
[2-(3,4-difluorophenyl)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate (PubChem CID 3373500) has the molecular formula C17H14F2N2O6 and a molecular weight of 380.30 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 3373500 |
| Molecular Formula | C17H14F2N2O6 |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1NCCO)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H14F2N2O6/c18-13-3-1-10(7-14(13)19)16(23)9-27-17(24)12-8-11(21(25)26)2-4-15(12)20-5-6-22/h1-4,7-8,20,22H,5-6,9H2 |
| InChIKey | CTEBBCTWONOIKG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|