C17H15Cl2N3O6 — CID 35986410
[2-(2,6-dichloroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate (PubChem CID 35986410) has the molecular formula C17H15Cl2N3O6 and a molecular weight of 428.23 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 35986410 |
| Molecular Formula | C17H15Cl2N3O6 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1NCCO)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H15Cl2N3O6/c18-12-2-1-3-13(19)16(12)21-15(24)9-28-17(25)11-8-10(22(26)27)4-5-14(11)20-6-7-23/h1-5,8,20,23H,6-7,9H2,(H,21,24) |
| InChIKey | XLTLEOQLWAXSRX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|