C17H15Cl2N3O5 — CID 7684906
[2-(2,6-dichloroanilino)-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate (PubChem CID 7684906) has the molecular formula C17H15Cl2N3O5 and a molecular weight of 412.23 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7684906 |
| Molecular Formula | C17H15Cl2N3O5 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H15Cl2N3O5/c1-21(2)14-7-6-10(22(25)26)8-11(14)17(24)27-9-15(23)20-16-12(18)4-3-5-13(16)19/h3-8H,9H2,1-2H3,(H,20,23) |
| InChIKey | JMCSQJFHRINYQC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|