C21H22N4O6 — CID 55467414
[2-[3-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate (PubChem CID 55467414) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is [2-[3-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate.
| Compound Name | [2-[3-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 55467414 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [2-[3-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)Nc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C21H22N4O6/c1-24(2)18-9-8-16(25(29)30)11-17(18)21(28)31-12-19(26)22-15-5-3-4-13(10-15)20(27)23-14-6-7-14/h3-5,8-11,14H,6-7,12H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | WXEXNBUWESEFEH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|