C22H27N5O4 — CID 55518296
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-2-(dimethylamino)-5-nitrobenzamide (PubChem CID 55518296) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-2-(dimethylamino)-5-nitrobenzamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-2-(dimethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 55518296 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-2-(dimethylamino)-5-nitrobenzamide |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)NC1CCN(CC(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N5O4/c1-25(2)20-9-8-18(27(30)31)14-19(20)22(29)24-17-10-12-26(13-11-17)15-21(28)23-16-6-4-3-5-7-16/h3-9,14,17H,10-13,15H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | LOHNCZOYQURUCU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|