C19H21N3O5 — CID 7684824
[2-(3,4-dimethylanilino)-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate (PubChem CID 7684824) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7684824 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2N(C)C)cc1C |
| InChI | InChI=1S/C19H21N3O5/c1-12-5-6-14(9-13(12)2)20-18(23)11-27-19(24)16-10-15(22(25)26)7-8-17(16)21(3)4/h5-10H,11H2,1-4H3,(H,20,23) |
| InChIKey | BWPRUKPNKUZLJL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|