C22H24N2O4 — CID 42039111
[2-[3-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2,4,6-trimethylbenzoate (PubChem CID 42039111) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [2-[3-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2,4,6-trimethylbenzoate.
| Compound Name | [2-[3-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 42039111 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [2-[3-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCC(=O)Nc2cccc(C(=O)NC3CC3)c2)c(C)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-13-9-14(2)20(15(3)10-13)22(27)28-12-19(25)23-18-6-4-5-16(11-18)21(26)24-17-7-8-17/h4-6,9-11,17H,7-8,12H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | QIUKZJDDKAYDLS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |