C20H22N2O3 — CID 24581450
N-cyclopropyl-3-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzamide (PubChem CID 24581450) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-cyclopropyl-3-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-3-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 24581450 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-cyclopropyl-3-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzamide |
| SMILES | Cc1ccc(C)c(OCC(=O)Nc2cccc(C(=O)NC3CC3)c2)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-13-6-7-14(2)18(10-13)25-12-19(23)21-17-5-3-4-15(11-17)20(24)22-16-8-9-16/h3-7,10-11,16H,8-9,12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | UYTZYIVZVYVSRN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |