C20H23NO4 — CID 19167371
propyl 3-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzoate (PubChem CID 19167371) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is propyl 3-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzoate.
| Compound Name | propyl 3-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19167371 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | propyl 3-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cccc(NC(=O)COc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C20H23NO4/c1-4-10-24-20(23)16-6-5-7-17(12-16)21-19(22)13-25-18-11-14(2)8-9-15(18)3/h5-9,11-12H,4,10,13H2,1-3H3,(H,21,22) |
| InChIKey | UCTHKUBYWGNTOD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |