C20H22BrNO5 — CID 19166247
2-ethoxyethyl 3-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]benzoate (PubChem CID 19166247) has the molecular formula C20H22BrNO5 and a molecular weight of 436.30 g/mol. Its IUPAC name is 2-ethoxyethyl 3-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]benzoate.
| Compound Name | 2-ethoxyethyl 3-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19166247 |
| Molecular Formula | C20H22BrNO5 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 2-ethoxyethyl 3-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]benzoate |
| SMILES | CCOCCOC(=O)c1cccc(NC(=O)COc2ccc(C)cc2Br)c1 |
| InChI | InChI=1S/C20H22BrNO5/c1-3-25-9-10-26-20(24)15-5-4-6-16(12-15)22-19(23)13-27-18-8-7-14(2)11-17(18)21/h4-8,11-12H,3,9-10,13H2,1-2H3,(H,22,23) |
| InChIKey | JTRDLMRBPDYQEP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|