C22H26BrNO4 — CID 19170367
hexyl 4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]benzoate (PubChem CID 19170367) has the molecular formula C22H26BrNO4 and a molecular weight of 448.36 g/mol. Its IUPAC name is hexyl 4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]benzoate.
| Compound Name | hexyl 4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19170367 |
| Molecular Formula | C22H26BrNO4 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | hexyl 4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NC(=O)COc2ccc(C)cc2Br)cc1 |
| InChI | InChI=1S/C22H26BrNO4/c1-3-4-5-6-13-27-22(26)17-8-10-18(11-9-17)24-21(25)15-28-20-12-7-16(2)14-19(20)23/h7-12,14H,3-6,13,15H2,1-2H3,(H,24,25) |
| InChIKey | DRARONOZEBWNAN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|