C23H28BrNO4 — CID 19166259
butyl 4-[[2-(4-bromo-2-tert-butylphenoxy)acetyl]amino]benzoate (PubChem CID 19166259) has the molecular formula C23H28BrNO4 and a molecular weight of 462.38 g/mol. Its IUPAC name is butyl 4-[[2-(4-bromo-2-tert-butylphenoxy)acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(4-bromo-2-tert-butylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19166259 |
| Molecular Formula | C23H28BrNO4 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | butyl 4-[[2-(4-bromo-2-tert-butylphenoxy)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COc2ccc(Br)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H28BrNO4/c1-5-6-13-28-22(27)16-7-10-18(11-8-16)25-21(26)15-29-20-12-9-17(24)14-19(20)23(2,3)4/h7-12,14H,5-6,13,15H2,1-4H3,(H,25,26) |
| InChIKey | PKWFDCSTLRJZML-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|