C24H31NO5 — CID 35270961
butyl 4-[[2-(2-tert-butyl-4-methoxyphenoxy)acetyl]amino]benzoate (PubChem CID 35270961) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is butyl 4-[[2-(2-tert-butyl-4-methoxyphenoxy)acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(2-tert-butyl-4-methoxyphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 35270961 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | butyl 4-[[2-(2-tert-butyl-4-methoxyphenoxy)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COc2ccc(OC)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31NO5/c1-6-7-14-29-23(27)17-8-10-18(11-9-17)25-22(26)16-30-21-13-12-19(28-5)15-20(21)24(2,3)4/h8-13,15H,6-7,14,16H2,1-5H3,(H,25,26) |
| InChIKey | GMDDHZOMMDWTLT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|